C17H21N3O6S — CID 51720295
3-[(R)-carboxy-(4-methylsulfonylpiperazin-1-yl)methyl]-1-methylindole-5-carboxylic acid (PubChem CID 51720295) has the molecular formula C17H21N3O6S and a molecular weight of 395.44 g/mol. Its IUPAC name is 3-[(R)-carboxy-(4-methylsulfonylpiperazin-1-yl)methyl]-1-methylindole-5-carboxylic acid.
| Compound Name | 3-[(R)-carboxy-(4-methylsulfonylpiperazin-1-yl)methyl]-1-methylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 51720295 |
| Molecular Formula | C17H21N3O6S |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | 3-[(R)-carboxy-(4-methylsulfonylpiperazin-1-yl)methyl]-1-methylindole-5-carboxylic acid |
| SMILES | Cn1cc([C@H](C(=O)O)N2CCN(S(C)(=O)=O)CC2)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C17H21N3O6S/c1-18-10-13(12-9-11(16(21)22)3-4-14(12)18)15(17(23)24)19-5-7-20(8-6-19)27(2,25)26/h3-4,9-10,15H,5-8H2,1-2H3,(H,21,22)(H,23,24)/t15-/m1/s1 |
| InChIKey | HCROCZODVXRRHU-OAHLLOKOSA-N |
| XLogP | 0.58 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |