C23H25N3O5 — CID 45494919
3-[carboxy-[4-(3-methoxyphenyl)piperazin-1-yl]methyl]-1-methylindole-6-carboxylic acid (PubChem CID 45494919) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 3-[carboxy-[4-(3-methoxyphenyl)piperazin-1-yl]methyl]-1-methylindole-6-carboxylic acid.
| Compound Name | 3-[carboxy-[4-(3-methoxyphenyl)piperazin-1-yl]methyl]-1-methylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 45494919 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 3-[carboxy-[4-(3-methoxyphenyl)piperazin-1-yl]methyl]-1-methylindole-6-carboxylic acid |
| SMILES | COc1cccc(N2CCN(C(C(=O)O)c3cn(C)c4cc(C(=O)O)ccc34)CC2)c1 |
| InChI | InChI=1S/C23H25N3O5/c1-24-14-19(18-7-6-15(22(27)28)12-20(18)24)21(23(29)30)26-10-8-25(9-11-26)16-4-3-5-17(13-16)31-2/h3-7,12-14,21H,8-11H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | AZEBGISFRGHEPZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 95.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |