C19H22N4O4 — CID 45495316
3-[carboxy-[4-(2-cyanoethyl)piperazin-1-yl]methyl]-1-methylindole-6-carboxylic acid (PubChem CID 45495316) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3-[carboxy-[4-(2-cyanoethyl)piperazin-1-yl]methyl]-1-methylindole-6-carboxylic acid.
| Compound Name | 3-[carboxy-[4-(2-cyanoethyl)piperazin-1-yl]methyl]-1-methylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 45495316 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-[carboxy-[4-(2-cyanoethyl)piperazin-1-yl]methyl]-1-methylindole-6-carboxylic acid |
| SMILES | Cn1cc(C(C(=O)O)N2CCN(CCC#N)CC2)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C19H22N4O4/c1-21-12-15(14-4-3-13(18(24)25)11-16(14)21)17(19(26)27)23-9-7-22(8-10-23)6-2-5-20/h3-4,11-12,17H,2,6-10H2,1H3,(H,24,25)(H,26,27) |
| InChIKey | ONECCGBTIMXEGL-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 109.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |