About 3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-carboxymethyl]-1-methylindole-5-carboxylic acid
3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-carboxymethyl]-1-methylindole-5-carboxylic acid (PubChem CID 45492183) has the molecular formula C23H22N4O4S
and a molecular weight of 450.52 g/mol. Its IUPAC name is 3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-carboxymethyl]-1-methylindole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-carboxymethyl]-1-methylindole-5-carboxylic acid |
| PubChem CID | 45492183 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | 3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-carboxymethyl]-1-methylindole-5-carboxylic acid |
| SMILES | Cn1cc(C(C(=O)O)N2CCN(c3nsc4ccccc34)CC2)c2cc(C(=O)O)ccc21 |
| InChI | InChI=1S/C23H22N4O4S/c1-25-13-17(16-12-14(22(28)29)6-7-18(16)25)20(23(30)31)26-8-10-27(11-9-26)21-15-4-2-3-5-19(15)32-24-21/h2-7,12-13,20H,8-11H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | OUKALAMJYBDHGM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-carboxymethyl]-1-methylindole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-carboxymethyl]-1-methylindole-5-carboxylic acid?
The IUPAC name of 3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-carboxymethyl]-1-methylindole-5-carboxylic acid (CID 45492183) is 3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-carboxymethyl]-1-methylindole-5-carboxylic acid.
What is the SMILES notation for 3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-carboxymethyl]-1-methylindole-5-carboxylic acid?
The canonical SMILES for 3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-carboxymethyl]-1-methylindole-5-carboxylic acid is Cn1cc(C(C(=O)O)N2CCN(c3nsc4ccccc34)CC2)c2cc(C(=O)O)ccc21.
What is the InChIKey of 3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-carboxymethyl]-1-methylindole-5-carboxylic acid?
The InChIKey is OUKALAMJYBDHGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O4S/c1-25-13-17(16-12-14(22(28)29)6-7-18(16)25)20(23(30)31)26-8-10-27(11-9-26)21-15-4-2-3-5-19(15)32-24-21/h2-7,12-13,20H,8-11H2,1H3,(H,28,29)(H,30,31).
What are the key properties of 3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-carboxymethyl]-1-methylindole-5-carboxylic acid?
3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-carboxymethyl]-1-methylindole-5-carboxylic acid has a molecular weight of 450.52 g/mol, XLogP of 3.43, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-carboxymethyl]-1-methylindole-5-carboxylic acid is sourced from PubChem (CID 45492183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).