C24H22N2O4 — CID 139664093
ethyl 4-[7-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methyl-2-oxochromen-3-yl]benzoate (PubChem CID 139664093) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is ethyl 4-[7-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methyl-2-oxochromen-3-yl]benzoate.
| Compound Name | ethyl 4-[7-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methyl-2-oxochromen-3-yl]benzoate |
|---|---|
| PubChem CID | 139664093 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | ethyl 4-[7-(3,5-dimethyl-1H-pyrazol-4-yl)-4-methyl-2-oxochromen-3-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2c(C)c3ccc(-c4c(C)n[nH]c4C)cc3oc2=O)cc1 |
| InChI | InChI=1S/C24H22N2O4/c1-5-29-23(27)17-8-6-16(7-9-17)21-13(2)19-11-10-18(12-20(19)30-24(21)28)22-14(3)25-26-15(22)4/h6-12H,5H2,1-4H3,(H,25,26) |
| InChIKey | CCAQLWPMSPLYKX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|