C30H48O4 — CID 139665941
3-acetyl-4-[(2R)-2-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-3-hydroxyhexane-2,5-dione (PubChem CID 139665941) has the molecular formula C30H48O4 and a molecular weight of 472.71 g/mol. Its IUPAC name is 3-acetyl-4-[(2R)-2-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-3-hydroxyhexane-2,5-dione.
| Compound Name | 3-acetyl-4-[(2R)-2-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-3-hydroxyhexane-2,5-dione |
|---|---|
| PubChem CID | 139665941 |
| Molecular Formula | C30H48O4 |
| Molecular Weight | 472.71 g/mol |
| Exact Mass | 472.36 |
| IUPAC Name | 3-acetyl-4-[(2R)-2-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propyl]-3-hydroxyhexane-2,5-dione |
| SMILES | CC(=O)C(C[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C)C(O)(C(C)=O)C(C)=O |
| InChI | InChI=1S/C30H48O4/c1-18(17-27(19(2)31)30(34,20(3)32)21(4)33)24-12-13-25-23-11-10-22-9-7-8-15-28(22,5)26(23)14-16-29(24,25)6/h18,22-27,34H,7-17H2,1-6H3/t18-,22?,23+,24-,25+,26+,27?,28+,29-/m1/s1 |
| InChIKey | CPGVTUXPDSYXGK-FDZWIJCZSA-N |
| XLogP | 6.18 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.71 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|