C27H46O7 — CID 142421274
(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3-dihydroxy-2-(trihydroxymethyl)heptanoic acid (PubChem CID 142421274) has the molecular formula C27H46O7 and a molecular weight of 482.66 g/mol. Its IUPAC name is (6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3-dihydroxy-2-(trihydroxymethyl)heptanoic acid.
| Compound Name | (6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3-dihydroxy-2-(trihydroxymethyl)heptanoic acid |
|---|---|
| PubChem CID | 142421274 |
| Molecular Formula | C27H46O7 |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.32 |
| IUPAC Name | (6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3-dihydroxy-2-(trihydroxymethyl)heptanoic acid |
| SMILES | C[C@H](CCC(O)C(O)(C(=O)O)C(O)(O)O)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H46O7/c1-16(7-12-22(28)26(31,23(29)30)27(32,33)34)19-10-11-20-18-9-8-17-6-4-5-14-24(17,2)21(18)13-15-25(19,20)3/h16-22,28,31-34H,4-15H2,1-3H3,(H,29,30)/t16-,17?,18+,19-,20+,21+,22?,24+,25-,26?/m1/s1 |
| InChIKey | RTRQJLZRDTZVDQ-SQBBHIBYSA-N |
| XLogP | 3.26 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|