C26H43NO6 — CID 87652220
2-[[(4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]-hydroxyamino]-2,2-dihydroxyacetic acid (PubChem CID 87652220) has the molecular formula C26H43NO6 and a molecular weight of 465.63 g/mol. Its IUPAC name is 2-[[(4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]-hydroxyamino]-2,2-dihydroxyacetic acid.
| Compound Name | 2-[[(4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]-hydroxyamino]-2,2-dihydroxyacetic acid |
|---|---|
| PubChem CID | 87652220 |
| Molecular Formula | C26H43NO6 |
| Molecular Weight | 465.63 g/mol |
| Exact Mass | 465.31 |
| IUPAC Name | 2-[[(4R)-4-[(5S,8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoyl]-hydroxyamino]-2,2-dihydroxyacetic acid |
| SMILES | C[C@H](CCC(=O)N(O)C(O)(O)C(=O)O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H43NO6/c1-16(7-12-22(28)27(33)26(31,32)23(29)30)19-10-11-20-18-9-8-17-6-4-5-14-24(17,2)21(18)13-15-25(19,20)3/h16-21,31-33H,4-15H2,1-3H3,(H,29,30)/t16-,17+,18+,19-,20+,21+,24+,25-/m1/s1 |
| InChIKey | DDGOKGMYJBDEIH-MFKGMXCUSA-N |
| XLogP | 4.39 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.63 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|