C27H46O6 — CID 71352640
(6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-hydroxy-2-(trihydroxymethyl)heptanoic acid (PubChem CID 71352640) has the molecular formula C27H46O6 and a molecular weight of 466.66 g/mol. Its IUPAC name is (6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-hydroxy-2-(trihydroxymethyl)heptanoic acid.
| Compound Name | (6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-hydroxy-2-(trihydroxymethyl)heptanoic acid |
|---|---|
| PubChem CID | 71352640 |
| Molecular Formula | C27H46O6 |
| Molecular Weight | 466.66 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | (6R)-6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-hydroxy-2-(trihydroxymethyl)heptanoic acid |
| SMILES | C[C@H](CCCC(O)(C(=O)O)C(O)(O)O)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H46O6/c1-17(7-6-15-26(30,23(28)29)27(31,32)33)20-11-12-21-19-10-9-18-8-4-5-14-24(18,2)22(19)13-16-25(20,21)3/h17-22,30-33H,4-16H2,1-3H3,(H,28,29)/t17-,18?,19+,20-,21+,22+,24+,25-,26?/m1/s1 |
| InChIKey | XCSJNCAMLZFDTK-RKHGRDCMSA-N |
| XLogP | 4.29 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.66 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|