C24H22ClN3O4S — CID 139666425
1-[6-chloro-8-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 139666425) has the molecular formula C24H22ClN3O4S and a molecular weight of 483.98 g/mol. Its IUPAC name is 1-[6-chloro-8-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-[6-chloro-8-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 139666425 |
| Molecular Formula | C24H22ClN3O4S |
| Molecular Weight | 483.98 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | 1-[6-chloro-8-(5,6-dihydroimidazo[2,1-b][1,3]thiazol-3-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]-3-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=CC(=O)N2CCOc3c(C4=CSC5=NCCN45)cc(Cl)cc32)cc1OC |
| InChI | InChI=1S/C24H22ClN3O4S/c1-30-20-5-3-15(11-21(20)31-2)4-6-22(29)27-9-10-32-23-17(12-16(25)13-18(23)27)19-14-33-24-26-7-8-28(19)24/h3-6,11-14H,7-10H2,1-2H3 |
| InChIKey | LKTOSEWMJJICDA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.98 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|