C12H25N3O3 — CID 139666952
tert-butyl N-[1-(dimethylcarbamoylamino)propyl]-N-methylcarbamate (PubChem CID 139666952) has the molecular formula C12H25N3O3 and a molecular weight of 259.35 g/mol. Its IUPAC name is tert-butyl N-[1-(dimethylcarbamoylamino)propyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-(dimethylcarbamoylamino)propyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 139666952 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | tert-butyl N-[1-(dimethylcarbamoylamino)propyl]-N-methylcarbamate |
| SMILES | CCC(NC(=O)N(C)C)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H25N3O3/c1-8-9(13-10(16)14(5)6)15(7)11(17)18-12(2,3)4/h9H,8H2,1-7H3,(H,13,16) |
| InChIKey | FUXBYBPVRHCEBS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|