C23H20N4O8S2 — CID 139667044
2-[[3-[(4-amino-1-methylpyrrole-2-carbonyl)amino]benzoyl]amino]naphthalene-1,5-disulfonic acid (PubChem CID 139667044) has the molecular formula C23H20N4O8S2 and a molecular weight of 544.57 g/mol. Its IUPAC name is 2-[[3-[(4-amino-1-methylpyrrole-2-carbonyl)amino]benzoyl]amino]naphthalene-1,5-disulfonic acid.
| Compound Name | 2-[[3-[(4-amino-1-methylpyrrole-2-carbonyl)amino]benzoyl]amino]naphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 139667044 |
| Molecular Formula | C23H20N4O8S2 |
| Molecular Weight | 544.57 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | 2-[[3-[(4-amino-1-methylpyrrole-2-carbonyl)amino]benzoyl]amino]naphthalene-1,5-disulfonic acid |
| SMILES | Cn1cc(N)cc1C(=O)Nc1cccc(C(=O)Nc2ccc3c(S(=O)(=O)O)cccc3c2S(=O)(=O)O)c1 |
| InChI | InChI=1S/C23H20N4O8S2/c1-27-12-14(24)11-19(27)23(29)25-15-5-2-4-13(10-15)22(28)26-18-9-8-16-17(21(18)37(33,34)35)6-3-7-20(16)36(30,31)32/h2-12H,24H2,1H3,(H,25,29)(H,26,28)(H,30,31,32)(H,33,34,35) |
| InChIKey | YKRQWQASIPIEDH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 197.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|