C23H18N4Na2O8S2 — CID 135340905
disodium;2-[[4-[(3-aminobenzoyl)amino]-1-methylpyrrole-2-carbonyl]amino]naphthalene-1,5-disulfonate (PubChem CID 135340905) has the molecular formula C23H18N4Na2O8S2 and a molecular weight of 588.53 g/mol. Its IUPAC name is disodium;2-[[4-[(3-aminobenzoyl)amino]-1-methylpyrrole-2-carbonyl]amino]naphthalene-1,5-disulfonate.
| Compound Name | disodium;2-[[4-[(3-aminobenzoyl)amino]-1-methylpyrrole-2-carbonyl]amino]naphthalene-1,5-disulfonate |
|---|---|
| PubChem CID | 135340905 |
| Molecular Formula | C23H18N4Na2O8S2 |
| Molecular Weight | 588.53 g/mol |
| Exact Mass | 588.04 |
| IUPAC Name | disodium;2-[[4-[(3-aminobenzoyl)amino]-1-methylpyrrole-2-carbonyl]amino]naphthalene-1,5-disulfonate |
| SMILES | Cn1cc(NC(=O)c2cccc(N)c2)cc1C(=O)Nc1ccc2c(S(=O)(=O)[O-])cccc2c1S(=O)(=O)[O-].[Na+].[Na+] |
| InChI | InChI=1S/C23H20N4O8S2.2Na/c1-27-12-15(25-22(28)13-4-2-5-14(24)10-13)11-19(27)23(29)26-18-9-8-16-17(21(18)37(33,34)35)6-3-7-20(16)36(30,31)32;;/h2-12H,24H2,1H3,(H,25,28)(H,26,29)(H,30,31,32)(H,33,34,35);;/q;2*+1/p-2 |
| InChIKey | SPZJRNVNYGFIFS-UHFFFAOYSA-L |
| XLogP | -3.92 |
| TPSA | 203.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.53 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|