C18H26FNO4Si — CID 139669335
[(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] 4-fluorobenzoate (PubChem CID 139669335) has the molecular formula C18H26FNO4Si and a molecular weight of 367.49 g/mol. Its IUPAC name is [(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] 4-fluorobenzoate.
| Compound Name | [(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 139669335 |
| Molecular Formula | C18H26FNO4Si |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | [(2R,3S)-3-[(1R)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidin-2-yl] 4-fluorobenzoate |
| SMILES | C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C(=O)N[C@@H]1OC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H26FNO4Si/c1-11(24-25(5,6)18(2,3)4)14-15(21)20-16(14)23-17(22)12-7-9-13(19)10-8-12/h7-11,14,16H,1-6H3,(H,20,21)/t11-,14-,16-/m1/s1 |
| InChIKey | BMZWAKNWXHGCNU-DJSGYFEHSA-N |
| XLogP | 3.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|