C21H31NO6Si — CID 134884035
benzyl (2R,3R)-2-acetyloxy-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidine-1-carboxylate (PubChem CID 134884035) has the molecular formula C21H31NO6Si and a molecular weight of 421.57 g/mol. Its IUPAC name is benzyl (2R,3R)-2-acetyloxy-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidine-1-carboxylate.
| Compound Name | benzyl (2R,3R)-2-acetyloxy-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidine-1-carboxylate |
|---|---|
| PubChem CID | 134884035 |
| Molecular Formula | C21H31NO6Si |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | benzyl (2R,3R)-2-acetyloxy-3-[(1S)-1-[tert-butyl(dimethyl)silyl]oxyethyl]-4-oxoazetidine-1-carboxylate |
| SMILES | CC(=O)O[C@@H]1[C@@H]([C@H](C)O[Si](C)(C)C(C)(C)C)C(=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H31NO6Si/c1-14(28-29(6,7)21(3,4)5)17-18(24)22(19(17)27-15(2)23)20(25)26-13-16-11-9-8-10-12-16/h8-12,14,17,19H,13H2,1-7H3/t14-,17-,19+/m0/s1 |
| InChIKey | LSDOIDXDPHUGBU-UCLAIMLFSA-N |
| XLogP | 4.08 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|