C19H23NO5 — CID 71575479
[(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 2-phenylmethoxyacetate (PubChem CID 71575479) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is [(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 2-phenylmethoxyacetate.
| Compound Name | [(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 2-phenylmethoxyacetate |
|---|---|
| PubChem CID | 71575479 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | [(1R)-1-[(3S)-2-oxo-1-pent-4-enoylazetidin-3-yl]ethyl] 2-phenylmethoxyacetate |
| SMILES | C=CCCC(=O)N1C[C@@H]([C@@H](C)OC(=O)COCc2ccccc2)C1=O |
| InChI | InChI=1S/C19H23NO5/c1-3-4-10-17(21)20-11-16(19(20)23)14(2)25-18(22)13-24-12-15-8-6-5-7-9-15/h3,5-9,14,16H,1,4,10-13H2,2H3/t14-,16+/m1/s1 |
| InChIKey | UNRCRMYCUUSWML-ZBFHGGJFSA-N |
| XLogP | 2.09 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|