C20H27N3O2 — CID 11717107
2-benzyl-4-methyl-8-pent-4-enoyl-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 11717107) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 2-benzyl-4-methyl-8-pent-4-enoyl-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 2-benzyl-4-methyl-8-pent-4-enoyl-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 11717107 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 2-benzyl-4-methyl-8-pent-4-enoyl-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | C=CCCC(=O)N1CCC2(CC1)NC(Cc1ccccc1)C(=O)N2C |
| InChI | InChI=1S/C20H27N3O2/c1-3-4-10-18(24)23-13-11-20(12-14-23)21-17(19(25)22(20)2)15-16-8-6-5-7-9-16/h3,5-9,17,21H,1,4,10-15H2,2H3 |
| InChIKey | LAWIVKFWSCHVPA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|