C66H78N4O11 — CID 174273398
methyl 2-[4,7,10-tris[1-oxo-1,3-bis(phenylmethoxy)propan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]hex-5-enoate (PubChem CID 174273398) has the molecular formula C66H78N4O11 and a molecular weight of 1103.37 g/mol. Its IUPAC name is methyl 2-[4,7,10-tris[1-oxo-1,3-bis(phenylmethoxy)propan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]hex-5-enoate.
| Compound Name | methyl 2-[4,7,10-tris[1-oxo-1,3-bis(phenylmethoxy)propan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]hex-5-enoate |
|---|---|
| PubChem CID | 174273398 |
| Molecular Formula | C66H78N4O11 |
| Molecular Weight | 1103.37 g/mol |
| Exact Mass | 1102.57 |
| IUPAC Name | methyl 2-[4,7,10-tris[1-oxo-1,3-bis(phenylmethoxy)propan-2-yl]-1,4,7,10-tetrazacyclododec-1-yl]hex-5-enoate |
| SMILES | C=CCCC(C(=O)OC)N1CCN(C(COCc2ccccc2)C(=O)OCc2ccccc2)CCN(C(COCc2ccccc2)C(=O)OCc2ccccc2)CCN(C(COCc2ccccc2)C(=O)OCc2ccccc2)CC1 |
| InChI | InChI=1S/C66H78N4O11/c1-3-4-35-59(63(71)75-2)67-36-38-68(60(50-76-44-53-23-11-5-12-24-53)64(72)79-47-56-29-17-8-18-30-56)40-42-70(62(52-78-46-55-27-15-7-16-28-55)66(74)81-49-58-33-21-10-22-34-58)43-41-69(39-37-67)61(51-77-45-54-25-13-6-14-26-54)65(73)80-48-57-31-19-9-20-32-57/h3,5-34,59-62H,1,4,35-52H2,2H3 |
| InChIKey | AWKIZNVUQZUVGG-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 145.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1103.37 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|