About benzyl 4-(3-amino-1-methoxy-1-oxopropan-2-yl)piperazine-1-carboxylate;dihydrochloride
benzyl 4-(3-amino-1-methoxy-1-oxopropan-2-yl)piperazine-1-carboxylate;dihydrochloride (PubChem CID 86675018) has the molecular formula C16H25Cl2N3O4
and a molecular weight of 394.30 g/mol. Its IUPAC name is benzyl 4-(3-amino-1-methoxy-1-oxopropan-2-yl)piperazine-1-carboxylate;dihydrochloride.
Molecular Properties
| Compound Name | benzyl 4-(3-amino-1-methoxy-1-oxopropan-2-yl)piperazine-1-carboxylate;dihydrochloride |
| PubChem CID | 86675018 |
| Molecular Formula | C16H25Cl2N3O4 |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | benzyl 4-(3-amino-1-methoxy-1-oxopropan-2-yl)piperazine-1-carboxylate;dihydrochloride |
| SMILES | COC(=O)C(CN)N1CCN(C(=O)OCc2ccccc2)CC1.Cl.Cl |
| InChI | InChI=1S/C16H23N3O4.2ClH/c1-22-15(20)14(11-17)18-7-9-19(10-8-18)16(21)23-12-13-5-3-2-4-6-13;;/h2-6,14H,7-12,17H2,1H3;2*1H |
| InChIKey | ZPIRCFJILDAAPW-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze benzyl 4-(3-amino-1-methoxy-1-oxopropan-2-yl)piperazine-1-carboxylate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 4-(3-amino-1-methoxy-1-oxopropan-2-yl)piperazine-1-carboxylate;dihydrochloride?
The IUPAC name of benzyl 4-(3-amino-1-methoxy-1-oxopropan-2-yl)piperazine-1-carboxylate;dihydrochloride (CID 86675018) is benzyl 4-(3-amino-1-methoxy-1-oxopropan-2-yl)piperazine-1-carboxylate;dihydrochloride.
What is the SMILES notation for benzyl 4-(3-amino-1-methoxy-1-oxopropan-2-yl)piperazine-1-carboxylate;dihydrochloride?
The canonical SMILES for benzyl 4-(3-amino-1-methoxy-1-oxopropan-2-yl)piperazine-1-carboxylate;dihydrochloride is COC(=O)C(CN)N1CCN(C(=O)OCc2ccccc2)CC1.Cl.Cl.
What is the InChIKey of benzyl 4-(3-amino-1-methoxy-1-oxopropan-2-yl)piperazine-1-carboxylate;dihydrochloride?
The InChIKey is ZPIRCFJILDAAPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N3O4.2ClH/c1-22-15(20)14(11-17)18-7-9-19(10-8-18)16(21)23-12-13-5-3-2-4-6-13;;/h2-6,14H,7-12,17H2,1H3;2*1H.
What are the key properties of benzyl 4-(3-amino-1-methoxy-1-oxopropan-2-yl)piperazine-1-carboxylate;dihydrochloride?
benzyl 4-(3-amino-1-methoxy-1-oxopropan-2-yl)piperazine-1-carboxylate;dihydrochloride has a molecular weight of 394.30 g/mol, XLogP of 1.28, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 4-(3-amino-1-methoxy-1-oxopropan-2-yl)piperazine-1-carboxylate;dihydrochloride is sourced from PubChem (CID 86675018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).