C22H35NO5Si — CID 23634960
tert-butyl (2S,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-3-phenylmethoxyazetidine-1-carboxylate (PubChem CID 23634960) has the molecular formula C22H35NO5Si and a molecular weight of 421.61 g/mol. Its IUPAC name is tert-butyl (2S,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-3-phenylmethoxyazetidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-3-phenylmethoxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 23634960 |
| Molecular Formula | C22H35NO5Si |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | tert-butyl (2S,3R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-3-phenylmethoxyazetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)[C@H](OCc2ccccc2)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H35NO5Si/c1-21(2,3)28-20(25)23-17(15-27-29(7,8)22(4,5)6)18(19(23)24)26-14-16-12-10-9-11-13-16/h9-13,17-18H,14-15H2,1-8H3/t17-,18+/m0/s1 |
| InChIKey | UFKICNRTTMWVRD-ZWKOTPCHSA-N |
| XLogP | 4.74 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|