C24H36F3N — CID 139670667
N-ethyl-1-[4-(4-propylcyclohexyl)cyclohexen-1-yl]-N-(trifluoromethyl)cyclohexa-2,4-dien-1-amine (PubChem CID 139670667) has the molecular formula C24H36F3N and a molecular weight of 395.55 g/mol. Its IUPAC name is N-ethyl-1-[4-(4-propylcyclohexyl)cyclohexen-1-yl]-N-(trifluoromethyl)cyclohexa-2,4-dien-1-amine.
| Compound Name | N-ethyl-1-[4-(4-propylcyclohexyl)cyclohexen-1-yl]-N-(trifluoromethyl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 139670667 |
| Molecular Formula | C24H36F3N |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.28 |
| IUPAC Name | N-ethyl-1-[4-(4-propylcyclohexyl)cyclohexen-1-yl]-N-(trifluoromethyl)cyclohexa-2,4-dien-1-amine |
| SMILES | CCCC1CCC(C2CC=C(C3(N(CC)C(F)(F)F)C=CC=CC3)CC2)CC1 |
| InChI | InChI=1S/C24H36F3N/c1-3-8-19-9-11-20(12-10-19)21-13-15-22(16-14-21)23(17-6-5-7-18-23)28(4-2)24(25,26)27/h5-7,15,17,19-21H,3-4,8-14,16,18H2,1-2H3 |
| InChIKey | NKPITDBZXJCEIO-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|