1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid

C11H12N2O3 — CID 139670868

IUPAC1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid
SMILESNC1(C(=O)O)NC(=O)CCc2ccccc21
InChIInChI=1S/C11H12N2O3/c12-11(10(15)16)8-4-2-1-3-7(8)5-6-9(14)13-11/h1-4H,5-6,12H2,(H,13,14)(H,15,16)
InChIKeyCJIQTINCSWOUAQ-UHFFFAOYSA-N
MW220.23 g/mol
LogP-0.05
Rot. Bonds1

About 1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid

1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid (PubChem CID 139670868) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid.

Molecular Properties

Compound Name1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid
PubChem CID139670868
Molecular FormulaC11H12N2O3
Molecular Weight220.23 g/mol
Exact Mass220.08
IUPAC Name1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid
SMILESNC1(C(=O)O)NC(=O)CCc2ccccc21
InChIInChI=1S/C11H12N2O3/c12-11(10(15)16)8-4-2-1-3-7(8)5-6-9(14)13-11/h1-4H,5-6,12H2,(H,13,14)(H,15,16)
InChIKeyCJIQTINCSWOUAQ-UHFFFAOYSA-N
XLogP-0.05
TPSA92.42 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.23
LogP ≤ 5-0.05
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid?
The IUPAC name of 1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid (CID 139670868) is 1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid.
What is the SMILES notation for 1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid?
The canonical SMILES for 1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid is NC1(C(=O)O)NC(=O)CCc2ccccc21.
What is the InChIKey of 1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid?
The InChIKey is CJIQTINCSWOUAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c12-11(10(15)16)8-4-2-1-3-7(8)5-6-9(14)13-11/h1-4H,5-6,12H2,(H,13,14)(H,15,16).
What are the key properties of 1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid?
1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid has a molecular weight of 220.23 g/mol, XLogP of -0.05, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid is sourced from PubChem (CID 139670868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).