C11H12N2O3 — CID 139670868
1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid (PubChem CID 139670868) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid.
| Compound Name | 1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid |
|---|---|
| PubChem CID | 139670868 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-amino-3-oxo-4,5-dihydro-2H-2-benzazepine-1-carboxylic acid |
| SMILES | NC1(C(=O)O)NC(=O)CCc2ccccc21 |
| InChI | InChI=1S/C11H12N2O3/c12-11(10(15)16)8-4-2-1-3-7(8)5-6-9(14)13-11/h1-4H,5-6,12H2,(H,13,14)(H,15,16) |
| InChIKey | CJIQTINCSWOUAQ-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |