C50H64Si3 — CID 139672608
di(butan-2-yl)-bis[4-[methyl(diphenyl)silyl]-2-propan-2-ylcyclopenta-2,4-dien-1-yl]silane (PubChem CID 139672608) has the molecular formula C50H64Si3 and a molecular weight of 749.32 g/mol. Its IUPAC name is di(butan-2-yl)-bis[4-[methyl(diphenyl)silyl]-2-propan-2-ylcyclopenta-2,4-dien-1-yl]silane.
| Compound Name | di(butan-2-yl)-bis[4-[methyl(diphenyl)silyl]-2-propan-2-ylcyclopenta-2,4-dien-1-yl]silane |
|---|---|
| PubChem CID | 139672608 |
| Molecular Formula | C50H64Si3 |
| Molecular Weight | 749.32 g/mol |
| Exact Mass | 748.43 |
| IUPAC Name | di(butan-2-yl)-bis[4-[methyl(diphenyl)silyl]-2-propan-2-ylcyclopenta-2,4-dien-1-yl]silane |
| SMILES | CCC(C)[Si](C(C)CC)(C1C=C([Si](C)(c2ccccc2)c2ccccc2)C=C1C(C)C)C1C=C([Si](C)(c2ccccc2)c2ccccc2)C=C1C(C)C |
| InChI | InChI=1S/C50H64Si3/c1-11-39(7)53(40(8)12-2,49-35-45(33-47(49)37(3)4)51(9,41-25-17-13-18-26-41)42-27-19-14-20-28-42)50-36-46(34-48(50)38(5)6)52(10,43-29-21-15-22-30-43)44-31-23-16-24-32-44/h13-40,49-50H,11-12H2,1-10H3 |
| InChIKey | NXJQHGXJLRGIFJ-UHFFFAOYSA-N |
| XLogP | 11.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.32 |
| LogP ≤ 5 | 11.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|