C34H48Si3 — CID 139672587
bis[4-[dimethyl(phenyl)silyl]-2-propan-2-ylcyclopenta-2,4-dien-1-yl]-dimethylsilane (PubChem CID 139672587) has the molecular formula C34H48Si3 and a molecular weight of 541.02 g/mol. Its IUPAC name is bis[4-[dimethyl(phenyl)silyl]-2-propan-2-ylcyclopenta-2,4-dien-1-yl]-dimethylsilane.
| Compound Name | bis[4-[dimethyl(phenyl)silyl]-2-propan-2-ylcyclopenta-2,4-dien-1-yl]-dimethylsilane |
|---|---|
| PubChem CID | 139672587 |
| Molecular Formula | C34H48Si3 |
| Molecular Weight | 541.02 g/mol |
| Exact Mass | 540.31 |
| IUPAC Name | bis[4-[dimethyl(phenyl)silyl]-2-propan-2-ylcyclopenta-2,4-dien-1-yl]-dimethylsilane |
| SMILES | CC(C)C1=CC([Si](C)(C)c2ccccc2)=CC1[Si](C)(C)C1C=C([Si](C)(C)c2ccccc2)C=C1C(C)C |
| InChI | InChI=1S/C34H48Si3/c1-25(2)31-21-29(35(5,6)27-17-13-11-14-18-27)23-33(31)37(9,10)34-24-30(22-32(34)26(3)4)36(7,8)28-19-15-12-16-20-28/h11-26,33-34H,1-10H3 |
| InChIKey | IZQBBVLPWJEYGX-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.02 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|