C16H16N4 — CID 139673479
10b-phenyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-amine (PubChem CID 139673479) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 10b-phenyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-amine.
| Compound Name | 10b-phenyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-amine |
|---|---|
| PubChem CID | 139673479 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 10b-phenyl-2,3-dihydro-1H-imidazo[1,2-c]quinazolin-5-amine |
| SMILES | NC1=Nc2ccccc2C2(c3ccccc3)NCCN12 |
| InChI | InChI=1S/C16H16N4/c17-15-19-14-9-5-4-8-13(14)16(18-10-11-20(15)16)12-6-2-1-3-7-12/h1-9,18H,10-11H2,(H2,17,19) |
| InChIKey | LFOPDAIWNTYCDL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |