About spiro[aziridine-2,3'-indole]
spiro[aziridine-2,3'-indole] (PubChem CID 173099784) has the molecular formula C9H8N2
and a molecular weight of 144.18 g/mol. Its IUPAC name is spiro[aziridine-2,3'-indole].
Molecular Properties
| Compound Name | spiro[aziridine-2,3'-indole] |
| PubChem CID | 173099784 |
| Molecular Formula | C9H8N2 |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.07 |
| IUPAC Name | spiro[aziridine-2,3'-indole] |
| SMILES | C1=Nc2ccccc2C12CN2 |
| InChI | InChI=1S/C9H8N2/c1-2-4-8-7(3-1)9(5-10-8)6-11-9/h1-5,11H,6H2 |
| InChIKey | WVDWRGPVYBDUAW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 34.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze spiro[aziridine-2,3'-indole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[aziridine-2,3'-indole]?
The IUPAC name of spiro[aziridine-2,3'-indole] (CID 173099784) is spiro[aziridine-2,3'-indole].
What is the SMILES notation for spiro[aziridine-2,3'-indole]?
The canonical SMILES for spiro[aziridine-2,3'-indole] is C1=Nc2ccccc2C12CN2.
What is the InChIKey of spiro[aziridine-2,3'-indole]?
The InChIKey is WVDWRGPVYBDUAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2/c1-2-4-8-7(3-1)9(5-10-8)6-11-9/h1-5,11H,6H2.
What are the key properties of spiro[aziridine-2,3'-indole]?
spiro[aziridine-2,3'-indole] has a molecular weight of 144.18 g/mol, XLogP of 1.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[aziridine-2,3'-indole] is sourced from PubChem (CID 173099784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).