C18H17N — CID 78152438
2-phenylspiro[cyclopentane-1,3'-indole] (PubChem CID 78152438) has the molecular formula C18H17N and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-phenylspiro[cyclopentane-1,3'-indole].
| Compound Name | 2-phenylspiro[cyclopentane-1,3'-indole] |
|---|---|
| PubChem CID | 78152438 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-phenylspiro[cyclopentane-1,3'-indole] |
| SMILES | C1=Nc2ccccc2C12CCCC2c1ccccc1 |
| InChI | InChI=1S/C18H17N/c1-2-7-14(8-3-1)15-10-6-12-18(15)13-19-17-11-5-4-9-16(17)18/h1-5,7-9,11,13,15H,6,10,12H2 |
| InChIKey | VFCHDJCFJPWARI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |