About 2-phenylspiro[cyclopentane-1,3'-indole]
2-phenylspiro[cyclopentane-1,3'-indole] (PubChem CID 78152438) has the molecular formula C18H17N
and a molecular weight of 247.34 g/mol. Its IUPAC name is 2-phenylspiro[cyclopentane-1,3'-indole].
Molecular Properties
| Compound Name | 2-phenylspiro[cyclopentane-1,3'-indole] |
| PubChem CID | 78152438 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 2-phenylspiro[cyclopentane-1,3'-indole] |
| SMILES | C1=Nc2ccccc2C12CCCC2c1ccccc1 |
| InChI | InChI=1S/C18H17N/c1-2-7-14(8-3-1)15-10-6-12-18(15)13-19-17-11-5-4-9-16(17)18/h1-5,7-9,11,13,15H,6,10,12H2 |
| InChIKey | VFCHDJCFJPWARI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenylspiro[cyclopentane-1,3'-indole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylspiro[cyclopentane-1,3'-indole]?
The IUPAC name of 2-phenylspiro[cyclopentane-1,3'-indole] (CID 78152438) is 2-phenylspiro[cyclopentane-1,3'-indole].
What is the SMILES notation for 2-phenylspiro[cyclopentane-1,3'-indole]?
The canonical SMILES for 2-phenylspiro[cyclopentane-1,3'-indole] is C1=Nc2ccccc2C12CCCC2c1ccccc1.
What is the InChIKey of 2-phenylspiro[cyclopentane-1,3'-indole]?
The InChIKey is VFCHDJCFJPWARI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17N/c1-2-7-14(8-3-1)15-10-6-12-18(15)13-19-17-11-5-4-9-16(17)18/h1-5,7-9,11,13,15H,6,10,12H2.
What are the key properties of 2-phenylspiro[cyclopentane-1,3'-indole]?
2-phenylspiro[cyclopentane-1,3'-indole] has a molecular weight of 247.34 g/mol, XLogP of 4.61, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylspiro[cyclopentane-1,3'-indole] is sourced from PubChem (CID 78152438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).