C18H20FO3P — CID 66796824
[1-(2-fluorophenyl)-2-phenylcyclohexyl]phosphonic acid (PubChem CID 66796824) has the molecular formula C18H20FO3P and a molecular weight of 334.33 g/mol. Its IUPAC name is [1-(2-fluorophenyl)-2-phenylcyclohexyl]phosphonic acid.
| Compound Name | [1-(2-fluorophenyl)-2-phenylcyclohexyl]phosphonic acid |
|---|---|
| PubChem CID | 66796824 |
| Molecular Formula | C18H20FO3P |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | [1-(2-fluorophenyl)-2-phenylcyclohexyl]phosphonic acid |
| SMILES | O=P(O)(O)C1(c2ccccc2F)CCCCC1c1ccccc1 |
| InChI | InChI=1S/C18H20FO3P/c19-17-12-5-4-11-16(17)18(23(20,21)22)13-7-6-10-15(18)14-8-2-1-3-9-14/h1-5,8-9,11-12,15H,6-7,10,13H2,(H2,20,21,22) |
| InChIKey | IEYROBXTZPBHCT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|