C19H17ClFN — CID 142671191
3-(3-chloro-5-fluorophenyl)spiro[cyclohexane-1,3'-indole] (PubChem CID 142671191) has the molecular formula C19H17ClFN and a molecular weight of 313.80 g/mol. Its IUPAC name is 3-(3-chloro-5-fluorophenyl)spiro[cyclohexane-1,3'-indole].
| Compound Name | 3-(3-chloro-5-fluorophenyl)spiro[cyclohexane-1,3'-indole] |
|---|---|
| PubChem CID | 142671191 |
| Molecular Formula | C19H17ClFN |
| Molecular Weight | 313.80 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 3-(3-chloro-5-fluorophenyl)spiro[cyclohexane-1,3'-indole] |
| SMILES | Fc1cc(Cl)cc(C2CCCC3(C=Nc4ccccc43)C2)c1 |
| InChI | InChI=1S/C19H17ClFN/c20-15-8-14(9-16(21)10-15)13-4-3-7-19(11-13)12-22-18-6-2-1-5-17(18)19/h1-2,5-6,8-10,12-13H,3-4,7,11H2 |
| InChIKey | QKNSHQRQXCYHHA-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.80 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |