C21H24N2 — CID 177414966
1'-(2,4,6-trimethylphenyl)spiro[indole-3,4'-piperidine] (PubChem CID 177414966) has the molecular formula C21H24N2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 1'-(2,4,6-trimethylphenyl)spiro[indole-3,4'-piperidine].
| Compound Name | 1'-(2,4,6-trimethylphenyl)spiro[indole-3,4'-piperidine] |
|---|---|
| PubChem CID | 177414966 |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 1'-(2,4,6-trimethylphenyl)spiro[indole-3,4'-piperidine] |
| SMILES | Cc1cc(C)c(N2CCC3(C=Nc4ccccc43)CC2)c(C)c1 |
| InChI | InChI=1S/C21H24N2/c1-15-12-16(2)20(17(3)13-15)23-10-8-21(9-11-23)14-22-19-7-5-4-6-18(19)21/h4-7,12-14H,8-11H2,1-3H3 |
| InChIKey | JKWGVORGECCASH-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |