C29H34N2 — CID 22020009
1,3-bis(2,4,6-trimethylphenyl)spiro[1,3-diazinane-2,7'-bicyclo[4.2.0]octa-1,3,5-triene] (PubChem CID 22020009) has the molecular formula C29H34N2 and a molecular weight of 410.61 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)spiro[1,3-diazinane-2,7'-bicyclo[4.2.0]octa-1,3,5-triene].
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)spiro[1,3-diazinane-2,7'-bicyclo[4.2.0]octa-1,3,5-triene] |
|---|---|
| PubChem CID | 22020009 |
| Molecular Formula | C29H34N2 |
| Molecular Weight | 410.61 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)spiro[1,3-diazinane-2,7'-bicyclo[4.2.0]octa-1,3,5-triene] |
| SMILES | Cc1cc(C)c(N2CCCN(c3c(C)cc(C)cc3C)C23Cc2ccccc23)c(C)c1 |
| InChI | InChI=1S/C29H34N2/c1-19-14-21(3)27(22(4)15-19)30-12-9-13-31(28-23(5)16-20(2)17-24(28)6)29(30)18-25-10-7-8-11-26(25)29/h7-8,10-11,14-17H,9,12-13,18H2,1-6H3 |
| InChIKey | YZZIKRZLBJPEJA-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |