C20H20N2O2 — CID 22601704
2-methyl-5-(3-nitrophenyl)spiro[cyclohexane-1,3'-indole] (PubChem CID 22601704) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-methyl-5-(3-nitrophenyl)spiro[cyclohexane-1,3'-indole].
| Compound Name | 2-methyl-5-(3-nitrophenyl)spiro[cyclohexane-1,3'-indole] |
|---|---|
| PubChem CID | 22601704 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-methyl-5-(3-nitrophenyl)spiro[cyclohexane-1,3'-indole] |
| SMILES | CC1CCC(c2cccc([N+](=O)[O-])c2)CC12C=Nc1ccccc12 |
| InChI | InChI=1S/C20H20N2O2/c1-14-9-10-16(15-5-4-6-17(11-15)22(23)24)12-20(14)13-21-19-8-3-2-7-18(19)20/h2-8,11,13-14,16H,9-10,12H2,1H3 |
| InChIKey | MSVDUMSCSFZMFN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|