C20H22N2O2 — CID 141028694
2'-methyl-5'-(3-nitrophenyl)spiro[1,2-dihydroindole-3,1'-cyclohexane] (PubChem CID 141028694) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2'-methyl-5'-(3-nitrophenyl)spiro[1,2-dihydroindole-3,1'-cyclohexane].
| Compound Name | 2'-methyl-5'-(3-nitrophenyl)spiro[1,2-dihydroindole-3,1'-cyclohexane] |
|---|---|
| PubChem CID | 141028694 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2'-methyl-5'-(3-nitrophenyl)spiro[1,2-dihydroindole-3,1'-cyclohexane] |
| SMILES | CC1CCC(c2cccc([N+](=O)[O-])c2)CC12CNc1ccccc12 |
| InChI | InChI=1S/C20H22N2O2/c1-14-9-10-16(15-5-4-6-17(11-15)22(23)24)12-20(14)13-21-19-8-3-2-7-18(19)20/h2-8,11,14,16,21H,9-10,12-13H2,1H3 |
| InChIKey | KXQMURYRQQNJAT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|