About 3-iodo-3-phenylindole
3-iodo-3-phenylindole (PubChem CID 175211436) has the molecular formula C14H10IN
and a molecular weight of 319.15 g/mol. Its IUPAC name is 3-iodo-3-phenylindole.
Molecular Properties
| Compound Name | 3-iodo-3-phenylindole |
| PubChem CID | 175211436 |
| Molecular Formula | C14H10IN |
| Molecular Weight | 319.15 g/mol |
| Exact Mass | 318.99 |
| IUPAC Name | 3-iodo-3-phenylindole |
| SMILES | IC1(c2ccccc2)C=Nc2ccccc21 |
| InChI | InChI=1S/C14H10IN/c15-14(11-6-2-1-3-7-11)10-16-13-9-5-4-8-12(13)14/h1-10H |
| InChIKey | DHZOHJQDFFVATR-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.15 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-3-phenylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-3-phenylindole?
The IUPAC name of 3-iodo-3-phenylindole (CID 175211436) is 3-iodo-3-phenylindole.
What is the SMILES notation for 3-iodo-3-phenylindole?
The canonical SMILES for 3-iodo-3-phenylindole is IC1(c2ccccc2)C=Nc2ccccc21.
What is the InChIKey of 3-iodo-3-phenylindole?
The InChIKey is DHZOHJQDFFVATR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10IN/c15-14(11-6-2-1-3-7-11)10-16-13-9-5-4-8-12(13)14/h1-10H.
What are the key properties of 3-iodo-3-phenylindole?
3-iodo-3-phenylindole has a molecular weight of 319.15 g/mol, XLogP of 4.08, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-3-phenylindole is sourced from PubChem (CID 175211436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).