spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid

C12H12N2O2 — CID 90702501

IUPACspiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid
SMILESO=C(O)C1CC2(C=Nc3ccccc32)CN1
InChIInChI=1S/C12H12N2O2/c15-11(16)10-5-12(7-14-10)6-13-9-4-2-1-3-8(9)12/h1-4,6,10,14H,5,7H2,(H,15,16)
InChIKeyFPONLMMQIJGRJM-UHFFFAOYSA-N
MW216.24 g/mol
LogP1.09
Rot. Bonds1

About spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid

spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid (PubChem CID 90702501) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid.

Molecular Properties

Compound Namespiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid
PubChem CID90702501
Molecular FormulaC12H12N2O2
Molecular Weight216.24 g/mol
Exact Mass216.09
IUPAC Namespiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid
SMILESO=C(O)C1CC2(C=Nc3ccccc32)CN1
InChIInChI=1S/C12H12N2O2/c15-11(16)10-5-12(7-14-10)6-13-9-4-2-1-3-8(9)12/h1-4,6,10,14H,5,7H2,(H,15,16)
InChIKeyFPONLMMQIJGRJM-UHFFFAOYSA-N
XLogP1.09
TPSA61.69 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.24
LogP ≤ 51.09
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid?
The IUPAC name of spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid (CID 90702501) is spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid.
What is the SMILES notation for spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid?
The canonical SMILES for spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid is O=C(O)C1CC2(C=Nc3ccccc32)CN1.
What is the InChIKey of spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid?
The InChIKey is FPONLMMQIJGRJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c15-11(16)10-5-12(7-14-10)6-13-9-4-2-1-3-8(9)12/h1-4,6,10,14H,5,7H2,(H,15,16).
What are the key properties of spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid?
spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid has a molecular weight of 216.24 g/mol, XLogP of 1.09, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid is sourced from PubChem (CID 90702501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).