C12H12N2O2 — CID 90702501
spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid (PubChem CID 90702501) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid.
| Compound Name | spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid |
|---|---|
| PubChem CID | 90702501 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | spiro[indole-3,4'-pyrrolidine]-2'-carboxylic acid |
| SMILES | O=C(O)C1CC2(C=Nc3ccccc32)CN1 |
| InChI | InChI=1S/C12H12N2O2/c15-11(16)10-5-12(7-14-10)6-13-9-4-2-1-3-8(9)12/h1-4,6,10,14H,5,7H2,(H,15,16) |
| InChIKey | FPONLMMQIJGRJM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |