C18H13NO — CID 122380476
3-phenylspiro[cyclopent-2-ene-4,3'-indole]-1-one (PubChem CID 122380476) has the molecular formula C18H13NO and a molecular weight of 259.31 g/mol. Its IUPAC name is 3-phenylspiro[cyclopent-2-ene-4,3'-indole]-1-one.
| Compound Name | 3-phenylspiro[cyclopent-2-ene-4,3'-indole]-1-one |
|---|---|
| PubChem CID | 122380476 |
| Molecular Formula | C18H13NO |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-phenylspiro[cyclopent-2-ene-4,3'-indole]-1-one |
| SMILES | O=C1C=C(c2ccccc2)C2(C=Nc3ccccc32)C1 |
| InChI | InChI=1S/C18H13NO/c20-14-10-16(13-6-2-1-3-7-13)18(11-14)12-19-17-9-5-4-8-15(17)18/h1-10,12H,11H2 |
| InChIKey | HSEOXXQEZBCTOB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |