C16H13NO2 — CID 151550167
5'-phenylspiro[1,3-dioxolane-2,3'-indole] (PubChem CID 151550167) has the molecular formula C16H13NO2 and a molecular weight of 251.29 g/mol. Its IUPAC name is 5'-phenylspiro[1,3-dioxolane-2,3'-indole].
| Compound Name | 5'-phenylspiro[1,3-dioxolane-2,3'-indole] |
|---|---|
| PubChem CID | 151550167 |
| Molecular Formula | C16H13NO2 |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 5'-phenylspiro[1,3-dioxolane-2,3'-indole] |
| SMILES | C1=Nc2ccc(-c3ccccc3)cc2C12OCCO2 |
| InChI | InChI=1S/C16H13NO2/c1-2-4-12(5-3-1)13-6-7-15-14(10-13)16(11-17-15)18-8-9-19-16/h1-7,10-11H,8-9H2 |
| InChIKey | QAHWFABGPNLCHW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |