C16H15NO3S2 — CID 139673517
benzyl (2R)-2-(thiophene-2-carbonyl)-1,3-thiazolidine-4-carboxylate (PubChem CID 139673517) has the molecular formula C16H15NO3S2 and a molecular weight of 333.43 g/mol. Its IUPAC name is benzyl (2R)-2-(thiophene-2-carbonyl)-1,3-thiazolidine-4-carboxylate.
| Compound Name | benzyl (2R)-2-(thiophene-2-carbonyl)-1,3-thiazolidine-4-carboxylate |
|---|---|
| PubChem CID | 139673517 |
| Molecular Formula | C16H15NO3S2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | benzyl (2R)-2-(thiophene-2-carbonyl)-1,3-thiazolidine-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1CS[C@H](C(=O)c2cccs2)N1 |
| InChI | InChI=1S/C16H15NO3S2/c18-14(13-7-4-8-21-13)15-17-12(10-22-15)16(19)20-9-11-5-2-1-3-6-11/h1-8,12,15,17H,9-10H2/t12?,15-/m1/s1 |
| InChIKey | GSHIJOXWFFGFNA-WPZCJLIBSA-N |
| XLogP | 2.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |