C18H11FN2S — CID 139674361
2-(4-fluorophenyl)-5-naphthalen-1-yl-1,3,4-thiadiazole (PubChem CID 139674361) has the molecular formula C18H11FN2S and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-naphthalen-1-yl-1,3,4-thiadiazole.
| Compound Name | 2-(4-fluorophenyl)-5-naphthalen-1-yl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 139674361 |
| Molecular Formula | C18H11FN2S |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 2-(4-fluorophenyl)-5-naphthalen-1-yl-1,3,4-thiadiazole |
| SMILES | Fc1ccc(-c2nnc(-c3cccc4ccccc34)s2)cc1 |
| InChI | InChI=1S/C18H11FN2S/c19-14-10-8-13(9-11-14)17-20-21-18(22-17)16-7-3-5-12-4-1-2-6-15(12)16/h1-11H |
| InChIKey | DMKROQXLGFQQOF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |