C16H18N4O4 — CID 139675431
3-(3,4-dimethoxyphenyl)-1-propyl-7H-purine-2,6-dione (PubChem CID 139675431) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-propyl-7H-purine-2,6-dione.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-propyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 139675431 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-propyl-7H-purine-2,6-dione |
| SMILES | CCCn1c(=O)c2[nH]cnc2n(-c2ccc(OC)c(OC)c2)c1=O |
| InChI | InChI=1S/C16H18N4O4/c1-4-7-19-15(21)13-14(18-9-17-13)20(16(19)22)10-5-6-11(23-2)12(8-10)24-3/h5-6,8-9H,4,7H2,1-3H3,(H,17,18) |
| InChIKey | PZOXGKRXBJUGQJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |