methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate

C14H11NO4 — CID 139676404

IUPACmethyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate
SMILESCOC(=O)Cc1cccc2oc(-c3ccco3)nc12
InChIInChI=1S/C14H11NO4/c1-17-12(16)8-9-4-2-5-10-13(9)15-14(19-10)11-6-3-7-18-11/h2-7H,8H2,1H3
InChIKeyABODJUYRYWMFQY-UHFFFAOYSA-N
MW257.25 g/mol
LogP2.80
Rot. Bonds3

About methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate

methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate (PubChem CID 139676404) has the molecular formula C14H11NO4 and a molecular weight of 257.25 g/mol. Its IUPAC name is methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate
PubChem CID139676404
Molecular FormulaC14H11NO4
Molecular Weight257.25 g/mol
Exact Mass257.07
IUPAC Namemethyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate
SMILESCOC(=O)Cc1cccc2oc(-c3ccco3)nc12
InChIInChI=1S/C14H11NO4/c1-17-12(16)8-9-4-2-5-10-13(9)15-14(19-10)11-6-3-7-18-11/h2-7H,8H2,1H3
InChIKeyABODJUYRYWMFQY-UHFFFAOYSA-N
XLogP2.80
TPSA65.47 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.25
LogP ≤ 52.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate?
The IUPAC name of methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate (CID 139676404) is methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate.
What is the SMILES notation for methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate?
The canonical SMILES for methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate is COC(=O)Cc1cccc2oc(-c3ccco3)nc12.
What is the InChIKey of methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate?
The InChIKey is ABODJUYRYWMFQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO4/c1-17-12(16)8-9-4-2-5-10-13(9)15-14(19-10)11-6-3-7-18-11/h2-7H,8H2,1H3.
What are the key properties of methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate?
methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate has a molecular weight of 257.25 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate is sourced from PubChem (CID 139676404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).