C14H11NO4 — CID 139676404
methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate (PubChem CID 139676404) has the molecular formula C14H11NO4 and a molecular weight of 257.25 g/mol. Its IUPAC name is methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate.
| Compound Name | methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate |
|---|---|
| PubChem CID | 139676404 |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.25 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | methyl 2-[2-(furan-2-yl)-1,3-benzoxazol-4-yl]acetate |
| SMILES | COC(=O)Cc1cccc2oc(-c3ccco3)nc12 |
| InChI | InChI=1S/C14H11NO4/c1-17-12(16)8-9-4-2-5-10-13(9)15-14(19-10)11-6-3-7-18-11/h2-7H,8H2,1H3 |
| InChIKey | ABODJUYRYWMFQY-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 65.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |