C20H22N2 — CID 139677245
3-(2-ethylhexyl)naphthalene-1,2-dicarbonitrile (PubChem CID 139677245) has the molecular formula C20H22N2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 3-(2-ethylhexyl)naphthalene-1,2-dicarbonitrile.
| Compound Name | 3-(2-ethylhexyl)naphthalene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 139677245 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 3-(2-ethylhexyl)naphthalene-1,2-dicarbonitrile |
| SMILES | CCCCC(CC)Cc1cc2ccccc2c(C#N)c1C#N |
| InChI | InChI=1S/C20H22N2/c1-3-5-8-15(4-2)11-17-12-16-9-6-7-10-18(16)20(14-22)19(17)13-21/h6-7,9-10,12,15H,3-5,8,11H2,1-2H3 |
| InChIKey | ZRZMVVZMQFZGEB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |