C18H18F2N4O3 — CID 139679080
7-[4-(cyanomethyl)piperazin-1-yl]-1-ethyl-6,8-difluoro-4-oxoquinoline-2-carboxylic acid (PubChem CID 139679080) has the molecular formula C18H18F2N4O3 and a molecular weight of 376.36 g/mol. Its IUPAC name is 7-[4-(cyanomethyl)piperazin-1-yl]-1-ethyl-6,8-difluoro-4-oxoquinoline-2-carboxylic acid.
| Compound Name | 7-[4-(cyanomethyl)piperazin-1-yl]-1-ethyl-6,8-difluoro-4-oxoquinoline-2-carboxylic acid |
|---|---|
| PubChem CID | 139679080 |
| Molecular Formula | C18H18F2N4O3 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 7-[4-(cyanomethyl)piperazin-1-yl]-1-ethyl-6,8-difluoro-4-oxoquinoline-2-carboxylic acid |
| SMILES | CCn1c(C(=O)O)cc(=O)c2cc(F)c(N3CCN(CC#N)CC3)c(F)c21 |
| InChI | InChI=1S/C18H18F2N4O3/c1-2-24-13(18(26)27)10-14(25)11-9-12(19)17(15(20)16(11)24)23-7-5-22(4-3-21)6-8-23/h9-10H,2,4-8H2,1H3,(H,26,27) |
| InChIKey | GUVMCBIJLVFFKS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|