C36H42N2O10 — CID 139680196
15-[4-(3,4-dimethoxyphenyl)butyl]-19-(5-phenylpentyl)-1,6,9,14-tetraoxa-15,19-diazadispiro[6.0.68.57]nonadeca-3,11-diene-2,5,10,13-tetrone (PubChem CID 139680196) has the molecular formula C36H42N2O10 and a molecular weight of 662.74 g/mol. Its IUPAC name is 15-[4-(3,4-dimethoxyphenyl)butyl]-19-(5-phenylpentyl)-1,6,9,14-tetraoxa-15,19-diazadispiro[6.0.68.57]nonadeca-3,11-diene-2,5,10,13-tetrone.
| Compound Name | 15-[4-(3,4-dimethoxyphenyl)butyl]-19-(5-phenylpentyl)-1,6,9,14-tetraoxa-15,19-diazadispiro[6.0.68.57]nonadeca-3,11-diene-2,5,10,13-tetrone |
|---|---|
| PubChem CID | 139680196 |
| Molecular Formula | C36H42N2O10 |
| Molecular Weight | 662.74 g/mol |
| Exact Mass | 662.28 |
| IUPAC Name | 15-[4-(3,4-dimethoxyphenyl)butyl]-19-(5-phenylpentyl)-1,6,9,14-tetraoxa-15,19-diazadispiro[6.0.68.57]nonadeca-3,11-diene-2,5,10,13-tetrone |
| SMILES | COc1ccc(CCCCN2CCCN(CCCCCc3ccccc3)C3(OC(=O)C=CC(=O)O3)C23OC(=O)C=CC(=O)O3)cc1OC |
| InChI | InChI=1S/C36H42N2O10/c1-43-29-17-16-28(26-30(29)44-2)15-8-10-23-38-25-11-24-37(22-9-4-7-14-27-12-5-3-6-13-27)35(45-31(39)18-19-32(40)46-35)36(38)47-33(41)20-21-34(42)48-36/h3,5-6,12-13,16-21,26H,4,7-11,14-15,22-25H2,1-2H3 |
| InChIKey | DZKXHASOGSNPBK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 130.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.74 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|