C18H31F3O3S2 — CID 139683378
[dimethyl(3,7,11-trimethyldodeca-2,6,10-trienyl)-λ4-sulfanyl] trifluoromethanesulfonate (PubChem CID 139683378) has the molecular formula C18H31F3O3S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is [dimethyl(3,7,11-trimethyldodeca-2,6,10-trienyl)-λ4-sulfanyl] trifluoromethanesulfonate.
| Compound Name | [dimethyl(3,7,11-trimethyldodeca-2,6,10-trienyl)-λ4-sulfanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139683378 |
| Molecular Formula | C18H31F3O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [dimethyl(3,7,11-trimethyldodeca-2,6,10-trienyl)-λ4-sulfanyl] trifluoromethanesulfonate |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCS(C)(C)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H31F3O3S2/c1-15(2)9-7-10-16(3)11-8-12-17(4)13-14-25(5,6)24-26(22,23)18(19,20)21/h9,11,13H,7-8,10,12,14H2,1-6H3 |
| InChIKey | ALUWIZWEUGWXQU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|