C38H46N2O5 — CID 139686955
(19S)-19-ethyl-19-hydroxy-16-[(9Z,12Z)-octadeca-9,12-dienoyl]-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione (PubChem CID 139686955) has the molecular formula C38H46N2O5 and a molecular weight of 610.80 g/mol. Its IUPAC name is (19S)-19-ethyl-19-hydroxy-16-[(9Z,12Z)-octadeca-9,12-dienoyl]-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione.
| Compound Name | (19S)-19-ethyl-19-hydroxy-16-[(9Z,12Z)-octadeca-9,12-dienoyl]-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 139686955 |
| Molecular Formula | C38H46N2O5 |
| Molecular Weight | 610.80 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | (19S)-19-ethyl-19-hydroxy-16-[(9Z,12Z)-octadeca-9,12-dienoyl]-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4,6,8,10,15(20)-heptaene-14,18-dione |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)C1OC(=O)[C@](O)(CC)c2cc3n(c(=O)c21)Cc1cc2ccccc2nc1-3 |
| InChI | InChI=1S/C38H46N2O5/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-23-32(41)35-33-29(38(44,4-2)37(43)45-35)25-31-34-28(26-40(31)36(33)42)24-27-21-19-20-22-30(27)39-34/h8-9,11-12,19-22,24-25,35,44H,3-7,10,13-18,23,26H2,1-2H3/b9-8-,12-11-/t35?,38-/m0/s1 |
| InChIKey | DLXJBLRJPDJOHE-JZAJXFJYSA-N |
| XLogP | 8.00 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.80 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|