C20H20N2O3S2 — CID 139687307
N-[4-[5-(pyridine-3-carbonyl)thiophen-3-yl]butyl]benzenesulfonamide (PubChem CID 139687307) has the molecular formula C20H20N2O3S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is N-[4-[5-(pyridine-3-carbonyl)thiophen-3-yl]butyl]benzenesulfonamide.
| Compound Name | N-[4-[5-(pyridine-3-carbonyl)thiophen-3-yl]butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 139687307 |
| Molecular Formula | C20H20N2O3S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | N-[4-[5-(pyridine-3-carbonyl)thiophen-3-yl]butyl]benzenesulfonamide |
| SMILES | O=C(c1cccnc1)c1cc(CCCCNS(=O)(=O)c2ccccc2)cs1 |
| InChI | InChI=1S/C20H20N2O3S2/c23-20(17-8-6-11-21-14-17)19-13-16(15-26-19)7-4-5-12-22-27(24,25)18-9-2-1-3-10-18/h1-3,6,8-11,13-15,22H,4-5,7,12H2 |
| InChIKey | JTKKEAFPWBEAKL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|