C21H22N2O3S2 — CID 139687226
N-[4-[2-formyl-5-(pyridin-3-ylmethyl)thiophen-3-yl]butyl]benzenesulfonamide (PubChem CID 139687226) has the molecular formula C21H22N2O3S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is N-[4-[2-formyl-5-(pyridin-3-ylmethyl)thiophen-3-yl]butyl]benzenesulfonamide.
| Compound Name | N-[4-[2-formyl-5-(pyridin-3-ylmethyl)thiophen-3-yl]butyl]benzenesulfonamide |
|---|---|
| PubChem CID | 139687226 |
| Molecular Formula | C21H22N2O3S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | N-[4-[2-formyl-5-(pyridin-3-ylmethyl)thiophen-3-yl]butyl]benzenesulfonamide |
| SMILES | O=Cc1sc(Cc2cccnc2)cc1CCCCNS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H22N2O3S2/c24-16-21-18(14-19(27-21)13-17-7-6-11-22-15-17)8-4-5-12-23-28(25,26)20-9-2-1-3-10-20/h1-3,6-7,9-11,14-16,23H,4-5,8,12-13H2 |
| InChIKey | FRCPZMPZXHZVDH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|