C20H25FN2O2S2 — CID 139687801
N-[(Z)-4-[5-[(dimethylamino)methyl]thiophen-3-yl]oxybut-1-enyl]-2-[(2-fluorophenyl)methylsulfanyl]acetamide (PubChem CID 139687801) has the molecular formula C20H25FN2O2S2 and a molecular weight of 408.56 g/mol. Its IUPAC name is N-[(Z)-4-[5-[(dimethylamino)methyl]thiophen-3-yl]oxybut-1-enyl]-2-[(2-fluorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(Z)-4-[5-[(dimethylamino)methyl]thiophen-3-yl]oxybut-1-enyl]-2-[(2-fluorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 139687801 |
| Molecular Formula | C20H25FN2O2S2 |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | N-[(Z)-4-[5-[(dimethylamino)methyl]thiophen-3-yl]oxybut-1-enyl]-2-[(2-fluorophenyl)methylsulfanyl]acetamide |
| SMILES | CN(C)Cc1cc(OCC/C=C\NC(=O)CSCc2ccccc2F)cs1 |
| InChI | InChI=1S/C20H25FN2O2S2/c1-23(2)12-18-11-17(14-27-18)25-10-6-5-9-22-20(24)15-26-13-16-7-3-4-8-19(16)21/h3-5,7-9,11,14H,6,10,12-13,15H2,1-2H3,(H,22,24)/b9-5- |
| InChIKey | JFHLSSVAQVEKEM-UITAMQMPSA-N |
| XLogP | 4.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|