C24H32N2O3S2 — CID 139687827
2-[(2-methoxyphenyl)methylsulfanyl]-N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]acetamide (PubChem CID 139687827) has the molecular formula C24H32N2O3S2 and a molecular weight of 460.67 g/mol. Its IUPAC name is 2-[(2-methoxyphenyl)methylsulfanyl]-N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]acetamide.
| Compound Name | 2-[(2-methoxyphenyl)methylsulfanyl]-N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]acetamide |
|---|---|
| PubChem CID | 139687827 |
| Molecular Formula | C24H32N2O3S2 |
| Molecular Weight | 460.67 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2-[(2-methoxyphenyl)methylsulfanyl]-N-[(Z)-4-[5-(piperidin-1-ylmethyl)thiophen-3-yl]oxybut-1-enyl]acetamide |
| SMILES | COc1ccccc1CSCC(=O)N/C=C\CCOc1csc(CN2CCCCC2)c1 |
| InChI | InChI=1S/C24H32N2O3S2/c1-28-23-10-4-3-9-20(23)17-30-19-24(27)25-11-5-8-14-29-21-15-22(31-18-21)16-26-12-6-2-7-13-26/h3-5,9-11,15,18H,2,6-8,12-14,16-17,19H2,1H3,(H,25,27)/b11-5- |
| InChIKey | BIEZMSBCSKPOCP-WZUFQYTHSA-N |
| XLogP | 5.07 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|